C15H13ClO5 — CID 20993147
3-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoic acid (PubChem CID 20993147) has the molecular formula C15H13ClO5 and a molecular weight of 308.72 g/mol. Its IUPAC name is 3-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoic acid.
| Compound Name | 3-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoic acid |
|---|---|
| PubChem CID | 20993147 |
| Molecular Formula | C15H13ClO5 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 3-[(8-chloro-4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]propanoic acid |
| SMILES | O=C(O)CCOc1cc2oc(=O)c3c(c2cc1Cl)CCC3 |
| InChI | InChI=1S/C15H13ClO5/c16-11-6-10-8-2-1-3-9(8)15(19)21-12(10)7-13(11)20-5-4-14(17)18/h6-7H,1-5H2,(H,17,18) |
| InChIKey | AVQFCVMVCRAMFJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|