C20H15ClF2O3 — CID 2210666
2-chloro-3-[(2,6-difluorophenyl)methoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 2210666) has the molecular formula C20H15ClF2O3 and a molecular weight of 376.79 g/mol. Its IUPAC name is 2-chloro-3-[(2,6-difluorophenyl)methoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 2-chloro-3-[(2,6-difluorophenyl)methoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 2210666 |
| Molecular Formula | C20H15ClF2O3 |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-chloro-3-[(2,6-difluorophenyl)methoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | O=c1oc2cc(OCc3c(F)cccc3F)c(Cl)cc2c2c1CCCC2 |
| InChI | InChI=1S/C20H15ClF2O3/c21-15-8-13-11-4-1-2-5-12(11)20(24)26-18(13)9-19(15)25-10-14-16(22)6-3-7-17(14)23/h3,6-9H,1-2,4-5,10H2 |
| InChIKey | JQFWGIZHVKYPAK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|