C18H13ClO4S — CID 1191210
(2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate (PubChem CID 1191210) has the molecular formula C18H13ClO4S and a molecular weight of 360.82 g/mol. Its IUPAC name is (2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate.
| Compound Name | (2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1191210 |
| Molecular Formula | C18H13ClO4S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | (2-chloro-6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) thiophene-2-carboxylate |
| SMILES | O=C(Oc1cc2oc(=O)c3c(c2cc1Cl)CCCC3)c1cccs1 |
| InChI | InChI=1S/C18H13ClO4S/c19-13-8-12-10-4-1-2-5-11(10)17(20)22-14(12)9-15(13)23-18(21)16-6-3-7-24-16/h3,6-9H,1-2,4-5H2 |
| InChIKey | VPNLQGVNVIVIQW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|