C16H11ClO4S — CID 1121158
(6-chloro-3,4-dimethyl-2-oxochromen-7-yl) thiophene-2-carboxylate (PubChem CID 1121158) has the molecular formula C16H11ClO4S and a molecular weight of 334.78 g/mol. Its IUPAC name is (6-chloro-3,4-dimethyl-2-oxochromen-7-yl) thiophene-2-carboxylate.
| Compound Name | (6-chloro-3,4-dimethyl-2-oxochromen-7-yl) thiophene-2-carboxylate |
|---|---|
| PubChem CID | 1121158 |
| Molecular Formula | C16H11ClO4S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (6-chloro-3,4-dimethyl-2-oxochromen-7-yl) thiophene-2-carboxylate |
| SMILES | Cc1c(C)c2cc(Cl)c(OC(=O)c3cccs3)cc2oc1=O |
| InChI | InChI=1S/C16H11ClO4S/c1-8-9(2)15(18)20-12-7-13(11(17)6-10(8)12)21-16(19)14-4-3-5-22-14/h3-7H,1-2H3 |
| InChIKey | CQULJQUEONGJFV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|