C24H24ClNO6 — CID 3759620
(6-chloro-3,4-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate (PubChem CID 3759620) has the molecular formula C24H24ClNO6 and a molecular weight of 457.91 g/mol. Its IUPAC name is (6-chloro-3,4-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate.
| Compound Name | (6-chloro-3,4-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 3759620 |
| Molecular Formula | C24H24ClNO6 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | (6-chloro-3,4-dimethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
| SMILES | Cc1c(C)c2cc(Cl)c(OC(=O)C(NC(=O)OC(C)(C)C)c3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C24H24ClNO6/c1-13-14(2)21(27)30-18-12-19(17(25)11-16(13)18)31-22(28)20(15-9-7-6-8-10-15)26-23(29)32-24(3,4)5/h6-12,20H,1-5H3,(H,26,29) |
| InChIKey | FKXWWPFCSGMRAC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|