C26H28ClNO6 — CID 3447835
(4-butyl-6-chloro-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate (PubChem CID 3447835) has the molecular formula C26H28ClNO6 and a molecular weight of 485.96 g/mol. Its IUPAC name is (4-butyl-6-chloro-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate.
| Compound Name | (4-butyl-6-chloro-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 3447835 |
| Molecular Formula | C26H28ClNO6 |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (4-butyl-6-chloro-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetate |
| SMILES | CCCCc1cc(=O)oc2cc(OC(=O)C(NC(=O)OC(C)(C)C)c3ccccc3)c(Cl)cc12 |
| InChI | InChI=1S/C26H28ClNO6/c1-5-6-10-17-13-22(29)32-20-15-21(19(27)14-18(17)20)33-24(30)23(16-11-8-7-9-12-16)28-25(31)34-26(2,3)4/h7-9,11-15,23H,5-6,10H2,1-4H3,(H,28,31) |
| InChIKey | CVANOTIJMKBHFV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|