C18H20ClNO6 — CID 4637000
(6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 4637000) has the molecular formula C18H20ClNO6 and a molecular weight of 381.81 g/mol. Its IUPAC name is (6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | (6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 4637000 |
| Molecular Formula | C18H20ClNO6 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | (6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CCc1cc(=O)oc2cc(OC(=O)CNC(=O)OC(C)(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C18H20ClNO6/c1-5-10-6-15(21)24-13-8-14(12(19)7-11(10)13)25-16(22)9-20-17(23)26-18(2,3)4/h6-8H,5,9H2,1-4H3,(H,20,23) |
| InChIKey | CKXAAIMWNPSVFO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|