C20H24ClNO6 — CID 3769927
(6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 3769927) has the molecular formula C20H24ClNO6 and a molecular weight of 409.87 g/mol. Its IUPAC name is (6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | (6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 3769927 |
| Molecular Formula | C20H24ClNO6 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (6-chloro-4-ethyl-2-oxochromen-7-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CCc1cc(=O)oc2cc(OC(=O)C(CC)NC(=O)OC(C)(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C20H24ClNO6/c1-6-11-8-17(23)26-15-10-16(13(21)9-12(11)15)27-18(24)14(7-2)22-19(25)28-20(3,4)5/h8-10,14H,6-7H2,1-5H3,(H,22,25) |
| InChIKey | XPIRRMATEDONSK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|