C23H28ClNO6 — CID 3718983
1-O-tert-butyl 2-O-(4-butyl-6-chloro-2-oxochromen-7-yl) pyrrolidine-1,2-dicarboxylate (PubChem CID 3718983) has the molecular formula C23H28ClNO6 and a molecular weight of 449.93 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(4-butyl-6-chloro-2-oxochromen-7-yl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(4-butyl-6-chloro-2-oxochromen-7-yl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 3718983 |
| Molecular Formula | C23H28ClNO6 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-O-tert-butyl 2-O-(4-butyl-6-chloro-2-oxochromen-7-yl) pyrrolidine-1,2-dicarboxylate |
| SMILES | CCCCc1cc(=O)oc2cc(OC(=O)C3CCCN3C(=O)OC(C)(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C23H28ClNO6/c1-5-6-8-14-11-20(26)29-18-13-19(16(24)12-15(14)18)30-21(27)17-9-7-10-25(17)22(28)31-23(2,3)4/h11-13,17H,5-10H2,1-4H3 |
| InChIKey | TYUTUABMUHOAQV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|