C25H25NO6 — CID 23880503
2-O-tert-butyl 1-O-(2-oxo-4-phenylchromen-7-yl) pyrrolidine-1,2-dicarboxylate (PubChem CID 23880503) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-(2-oxo-4-phenylchromen-7-yl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-(2-oxo-4-phenylchromen-7-yl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23880503 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-O-tert-butyl 1-O-(2-oxo-4-phenylchromen-7-yl) pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN1C(=O)Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H25NO6/c1-25(2,3)32-23(28)20-10-7-13-26(20)24(29)30-17-11-12-18-19(16-8-5-4-6-9-16)15-22(27)31-21(18)14-17/h4-6,8-9,11-12,14-15,20H,7,10,13H2,1-3H3 |
| InChIKey | QZMXIPOVRUGBNG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|