C25H23NO6 — CID 4904399
1-O-benzyl 2-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) pyrrolidine-1,2-dicarboxylate (PubChem CID 4904399) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is 1-O-benzyl 2-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 4904399 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-O-benzyl 2-O-(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl) pyrrolidine-1,2-dicarboxylate |
| SMILES | O=C(Oc1ccc2c3c(c(=O)oc2c1)CCC3)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H23NO6/c27-23-20-9-4-8-18(20)19-12-11-17(14-22(19)32-23)31-24(28)21-10-5-13-26(21)25(29)30-15-16-6-2-1-3-7-16/h1-3,6-7,11-12,14,21H,4-5,8-10,13,15H2 |
| InChIKey | MQMGAKNWVAEYJX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|