C25H25NO6 — CID 6573823
1-O-benzyl 2-O-(3,4,8-trimethyl-2-oxochromen-7-yl) (2R)-pyrrolidine-1,2-dicarboxylate (PubChem CID 6573823) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-O-benzyl 2-O-(3,4,8-trimethyl-2-oxochromen-7-yl) (2R)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-(3,4,8-trimethyl-2-oxochromen-7-yl) (2R)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 6573823 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 1-O-benzyl 2-O-(3,4,8-trimethyl-2-oxochromen-7-yl) (2R)-pyrrolidine-1,2-dicarboxylate |
| SMILES | Cc1c(C)c2ccc(OC(=O)[C@H]3CCCN3C(=O)OCc3ccccc3)c(C)c2oc1=O |
| InChI | InChI=1S/C25H25NO6/c1-15-16(2)23(27)32-22-17(3)21(12-11-19(15)22)31-24(28)20-10-7-13-26(20)25(29)30-14-18-8-5-4-6-9-18/h4-6,8-9,11-12,20H,7,10,13-14H2,1-3H3/t20-/m1/s1 |
| InChIKey | XFWOLJATVCQZLU-HXUWFJFHSA-N |
| XLogP | 4.42 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|