C28H29NO6 — CID 23746376
(6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) 4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate (PubChem CID 23746376) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) 4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate.
| Compound Name | (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) 4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 23746376 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | (6-oxo-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) 4-(phenylmethoxycarbonylamino)cyclohexane-1-carboxylate |
| SMILES | O=C(NC1CCC(C(=O)Oc2ccc3c4c(c(=O)oc3c2)CCCC4)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C28H29NO6/c30-26(19-10-12-20(13-11-19)29-28(32)33-17-18-6-2-1-3-7-18)34-21-14-15-23-22-8-4-5-9-24(22)27(31)35-25(23)16-21/h1-3,6-7,14-16,19-20H,4-5,8-13,17H2,(H,29,32) |
| InChIKey | XHXQCDKABYAAKT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|