C32H31NO7 — CID 3777606
[3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate (PubChem CID 3777606) has the molecular formula C32H31NO7 and a molecular weight of 541.60 g/mol. Its IUPAC name is [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate.
| Compound Name | [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 3777606 |
| Molecular Formula | C32H31NO7 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | [3-(4-methoxyphenyl)-4-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate |
| SMILES | COc1ccc(-c2coc3cc(OC(=O)C4CCC(CNC(=O)OCc5ccccc5)CC4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C32H31NO7/c1-37-25-13-11-23(12-14-25)28-20-38-29-17-26(15-16-27(29)30(28)34)40-31(35)24-9-7-21(8-10-24)18-33-32(36)39-19-22-5-3-2-4-6-22/h2-6,11-17,20-21,24H,7-10,18-19H2,1H3,(H,33,36) |
| InChIKey | CDOIKDNANWUOBA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|