C31H28ClNO6 — CID 3350467
[3-(4-chlorophenyl)-2-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate (PubChem CID 3350467) has the molecular formula C31H28ClNO6 and a molecular weight of 546.02 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-2-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate.
| Compound Name | [3-(4-chlorophenyl)-2-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 3350467 |
| Molecular Formula | C31H28ClNO6 |
| Molecular Weight | 546.02 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | [3-(4-chlorophenyl)-2-oxochromen-7-yl] 4-(phenylmethoxycarbonylaminomethyl)cyclohexane-1-carboxylate |
| SMILES | O=C(NCC1CCC(C(=O)Oc2ccc3cc(-c4ccc(Cl)cc4)c(=O)oc3c2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C31H28ClNO6/c32-25-13-10-22(11-14-25)27-16-24-12-15-26(17-28(24)39-30(27)35)38-29(34)23-8-6-20(7-9-23)18-33-31(36)37-19-21-4-2-1-3-5-21/h1-5,10-17,20,23H,6-9,18-19H2,(H,33,36) |
| InChIKey | AAUKUEMXLDBCDA-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.02 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|