C26H20ClNO6 — CID 92851479
[3-(4-chlorophenyl)-4-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 92851479) has the molecular formula C26H20ClNO6 and a molecular weight of 477.90 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-4-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | [3-(4-chlorophenyl)-4-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 92851479 |
| Molecular Formula | C26H20ClNO6 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | [3-(4-chlorophenyl)-4-oxochromen-7-yl] (2R)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C[C@@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc2c(=O)c(-c3ccc(Cl)cc3)coc2c1 |
| InChI | InChI=1S/C26H20ClNO6/c1-16(28-26(31)33-14-17-5-3-2-4-6-17)25(30)34-20-11-12-21-23(13-20)32-15-22(24(21)29)18-7-9-19(27)10-8-18/h2-13,15-16H,14H2,1H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | JCIZBDXGBYAYFI-MRXNPFEDSA-N |
| XLogP | 5.33 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|