C29H27NO7 — CID 6578579
(4-oxo-3-phenoxychromen-7-yl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 6578579) has the molecular formula C29H27NO7 and a molecular weight of 501.54 g/mol. Its IUPAC name is (4-oxo-3-phenoxychromen-7-yl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | (4-oxo-3-phenoxychromen-7-yl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 6578579 |
| Molecular Formula | C29H27NO7 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | (4-oxo-3-phenoxychromen-7-yl) (2S,3R)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC[C@@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc2c(=O)c(Oc3ccccc3)coc2c1 |
| InChI | InChI=1S/C29H27NO7/c1-3-19(2)26(30-29(33)35-17-20-10-6-4-7-11-20)28(32)37-22-14-15-23-24(16-22)34-18-25(27(23)31)36-21-12-8-5-9-13-21/h4-16,18-19,26H,3,17H2,1-2H3,(H,30,33)/t19-,26+/m1/s1 |
| InChIKey | JAOJZEDUSCGTKU-BCHFMIIMSA-N |
| XLogP | 5.83 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|