C28H25NO7 — CID 1287018
(4-oxo-3-phenoxychromen-7-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 1287018) has the molecular formula C28H25NO7 and a molecular weight of 487.51 g/mol. Its IUPAC name is (4-oxo-3-phenoxychromen-7-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | (4-oxo-3-phenoxychromen-7-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 1287018 |
| Molecular Formula | C28H25NO7 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (4-oxo-3-phenoxychromen-7-yl) (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)Oc1ccc2c(=O)c(Oc3ccccc3)coc2c1 |
| InChI | InChI=1S/C28H25NO7/c1-18(2)25(29-28(32)34-16-19-9-5-3-6-10-19)27(31)36-21-13-14-22-23(15-21)33-17-24(26(22)30)35-20-11-7-4-8-12-20/h3-15,17-18,25H,16H2,1-2H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | WWQOSNYHYBUXEN-VWLOTQADSA-N |
| XLogP | 5.44 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|