benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate

C25H20O7 — CID 1182996

IUPACbenzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate
SMILESCOc1ccc(Oc2coc3cc(OCC(=O)OCc4ccccc4)ccc3c2=O)cc1
InChIInChI=1S/C25H20O7/c1-28-18-7-9-19(10-8-18)32-23-15-30-22-13-20(11-12-21(22)25(23)27)29-16-24(26)31-14-17-5-3-2-4-6-17/h2-13,15H,14,16H2,1H3
InChIKeyALVHNVKLPJPZSH-UHFFFAOYSA-N
MW432.43 g/mol
LogP4.72
Rot. Bonds8

About benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate

benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate (PubChem CID 1182996) has the molecular formula C25H20O7 and a molecular weight of 432.43 g/mol. Its IUPAC name is benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate.

Molecular Properties

Compound Namebenzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate
PubChem CID1182996
Molecular FormulaC25H20O7
Molecular Weight432.43 g/mol
Exact Mass432.12
IUPAC Namebenzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate
SMILESCOc1ccc(Oc2coc3cc(OCC(=O)OCc4ccccc4)ccc3c2=O)cc1
InChIInChI=1S/C25H20O7/c1-28-18-7-9-19(10-8-18)32-23-15-30-22-13-20(11-12-21(22)25(23)27)29-16-24(26)31-14-17-5-3-2-4-6-17/h2-13,15H,14,16H2,1H3
InChIKeyALVHNVKLPJPZSH-UHFFFAOYSA-N
XLogP4.72
TPSA84.20 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms32
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500432.43
LogP ≤ 54.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate?
The IUPAC name of benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate (CID 1182996) is benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate.
What is the SMILES notation for benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate?
The canonical SMILES for benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate is COc1ccc(Oc2coc3cc(OCC(=O)OCc4ccccc4)ccc3c2=O)cc1.
What is the InChIKey of benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate?
The InChIKey is ALVHNVKLPJPZSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20O7/c1-28-18-7-9-19(10-8-18)32-23-15-30-22-13-20(11-12-21(22)25(23)27)29-16-24(26)31-14-17-5-3-2-4-6-17/h2-13,15H,14,16H2,1H3.
What are the key properties of benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate?
benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate has a molecular weight of 432.43 g/mol, XLogP of 4.72, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[3-(4-methoxyphenoxy)-4-oxochromen-7-yl]oxyacetate is sourced from PubChem (CID 1182996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).