C23H18NO7- — CID 163138200
7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-3-(4-methoxyphenoxy)chromen-4-one (PubChem CID 163138200) has the molecular formula C23H18NO7- and a molecular weight of 420.40 g/mol. Its IUPAC name is 7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-3-(4-methoxyphenoxy)chromen-4-one.
| Compound Name | 7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-3-(4-methoxyphenoxy)chromen-4-one |
|---|---|
| PubChem CID | 163138200 |
| Molecular Formula | C23H18NO7- |
| Molecular Weight | 420.40 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 7-[[4-[hydroxy(oxido)amino]phenyl]methoxy]-3-(4-methoxyphenoxy)chromen-4-one |
| SMILES | COc1ccc(Oc2coc3cc(OCc4ccc(N([O-])O)cc4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H18NO7/c1-28-17-6-8-18(9-7-17)31-22-14-30-21-12-19(10-11-20(21)23(22)25)29-13-15-2-4-16(5-3-15)24(26)27/h2-12,14,26H,13H2,1H3/q-1 |
| InChIKey | XGMUDNPEGXJONO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|