C23H17O7- — CID 7138904
5-[[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate (PubChem CID 7138904) has the molecular formula C23H17O7- and a molecular weight of 405.38 g/mol. Its IUPAC name is 5-[[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate.
| Compound Name | 5-[[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7138904 |
| Molecular Formula | C23H17O7- |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 5-[[3-(4-ethylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate |
| SMILES | CCc1ccc(Oc2coc3cc(OCc4ccc(C(=O)[O-])o4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H18O7/c1-2-14-3-5-15(6-4-14)29-21-13-28-20-11-16(7-9-18(20)22(21)24)27-12-17-8-10-19(30-17)23(25)26/h3-11,13H,2,12H2,1H3,(H,25,26)/p-1 |
| InChIKey | DASFPORKLFTAFP-UHFFFAOYSA-M |
| XLogP | 3.68 |
| TPSA | 101.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |