C22H15O7- — CID 7138892
5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate (PubChem CID 7138892) has the molecular formula C22H15O7- and a molecular weight of 391.36 g/mol. Its IUPAC name is 5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate.
| Compound Name | 5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7138892 |
| Molecular Formula | C22H15O7- |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate |
| SMILES | Cc1cccc(Oc2coc3cc(OCc4ccc(C(=O)[O-])o4)ccc3c2=O)c1 |
| InChI | InChI=1S/C22H16O7/c1-13-3-2-4-15(9-13)28-20-12-27-19-10-14(5-7-17(19)21(20)23)26-11-16-6-8-18(29-16)22(24)25/h2-10,12H,11H2,1H3,(H,24,25)/p-1 |
| InChIKey | QVTOHJSZCDBBJU-UHFFFAOYSA-M |
| XLogP | 3.43 |
| TPSA | 101.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |