C26H24O7 — CID 7895955
5-[[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid (PubChem CID 7895955) has the molecular formula C26H24O7 and a molecular weight of 448.47 g/mol. Its IUPAC name is 5-[[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 7895955 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 5-[[3-[4-(2-methylbutan-2-yl)phenoxy]-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid |
| SMILES | CCC(C)(C)c1ccc(Oc2coc3cc(OCc4ccc(C(=O)O)o4)ccc3c2=O)cc1 |
| InChI | InChI=1S/C26H24O7/c1-4-26(2,3)16-5-7-17(8-6-16)32-23-15-31-22-13-18(9-11-20(22)24(23)27)30-14-19-10-12-21(33-19)25(28)29/h5-13,15H,4,14H2,1-3H3,(H,28,29) |
| InChIKey | GDKPDAUOQBDNFN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |