C21H11Cl2O7- — CID 7895948
5-[[3-(2,5-dichlorophenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate (PubChem CID 7895948) has the molecular formula C21H11Cl2O7- and a molecular weight of 446.22 g/mol. Its IUPAC name is 5-[[3-(2,5-dichlorophenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate.
| Compound Name | 5-[[3-(2,5-dichlorophenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 7895948 |
| Molecular Formula | C21H11Cl2O7- |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | 5-[[3-(2,5-dichlorophenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylate |
| SMILES | O=C([O-])c1ccc(COc2ccc3c(=O)c(Oc4cc(Cl)ccc4Cl)coc3c2)o1 |
| InChI | InChI=1S/C21H12Cl2O7/c22-11-1-5-15(23)18(7-11)30-19-10-28-17-8-12(2-4-14(17)20(19)24)27-9-13-3-6-16(29-13)21(25)26/h1-8,10H,9H2,(H,25,26)/p-1 |
| InChIKey | YPIMLIHOEMQTDK-UHFFFAOYSA-M |
| XLogP | 4.43 |
| TPSA | 101.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |