C22H16O7 — CID 7138893
5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid (PubChem CID 7138893) has the molecular formula C22H16O7 and a molecular weight of 392.36 g/mol. Its IUPAC name is 5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 7138893 |
| Molecular Formula | C22H16O7 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 5-[[3-(3-methylphenoxy)-4-oxochromen-7-yl]oxymethyl]furan-2-carboxylic acid |
| SMILES | Cc1cccc(Oc2coc3cc(OCc4ccc(C(=O)O)o4)ccc3c2=O)c1 |
| InChI | InChI=1S/C22H16O7/c1-13-3-2-4-15(9-13)28-20-12-27-19-10-14(5-7-17(19)21(20)23)26-11-16-6-8-18(29-16)22(24)25/h2-10,12H,11H2,1H3,(H,24,25) |
| InChIKey | QVTOHJSZCDBBJU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |