About [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate
[3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate (PubChem CID 1182984) has the molecular formula C23H15FO5
and a molecular weight of 390.37 g/mol. Its IUPAC name is [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate |
| PubChem CID | 1182984 |
| Molecular Formula | C23H15FO5 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate |
| SMILES | Cc1cccc(Oc2coc3cc(OC(=O)c4ccc(F)cc4)ccc3c2=O)c1 |
| InChI | InChI=1S/C23H15FO5/c1-14-3-2-4-17(11-14)28-21-13-27-20-12-18(9-10-19(20)22(21)25)29-23(26)15-5-7-16(24)8-6-15/h2-13H,1H3 |
| InChIKey | HDZDFARTYMIZEW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate?
The IUPAC name of [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate (CID 1182984) is [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate.
What is the SMILES notation for [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate?
The canonical SMILES for [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate is Cc1cccc(Oc2coc3cc(OC(=O)c4ccc(F)cc4)ccc3c2=O)c1.
What is the InChIKey of [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate?
The InChIKey is HDZDFARTYMIZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15FO5/c1-14-3-2-4-17(11-14)28-21-13-27-20-12-18(9-10-19(20)22(21)25)29-23(26)15-5-7-16(24)8-6-15/h2-13H,1H3.
What are the key properties of [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate?
[3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate has a molecular weight of 390.37 g/mol, XLogP of 5.25, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-methylphenoxy)-4-oxochromen-7-yl] 4-fluorobenzoate is sourced from PubChem (CID 1182984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).