C13H10Cl2O4 — CID 950139
methyl 5-[(2,5-dichlorophenoxy)methyl]furan-2-carboxylate (PubChem CID 950139) has the molecular formula C13H10Cl2O4 and a molecular weight of 301.12 g/mol. Its IUPAC name is methyl 5-[(2,5-dichlorophenoxy)methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(2,5-dichlorophenoxy)methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 950139 |
| Molecular Formula | C13H10Cl2O4 |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | methyl 5-[(2,5-dichlorophenoxy)methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C13H10Cl2O4/c1-17-13(16)11-5-3-9(19-11)7-18-12-6-8(14)2-4-10(12)15/h2-6H,7H2,1H3 |
| InChIKey | SUGGFFIUTHZCOF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |