About [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine
[5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine (PubChem CID 62452227) has the molecular formula C12H11Cl2NO2
and a molecular weight of 272.13 g/mol. Its IUPAC name is [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine |
| PubChem CID | 62452227 |
| Molecular Formula | C12H11Cl2NO2 |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine |
| SMILES | NCc1ccc(COc2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C12H11Cl2NO2/c13-8-1-4-11(14)12(5-8)16-7-10-3-2-9(6-15)17-10/h1-5H,6-7,15H2 |
| InChIKey | VIGACGRDZRJINO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine?
The IUPAC name of [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine (CID 62452227) is [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine.
What is the SMILES notation for [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine?
The canonical SMILES for [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine is NCc1ccc(COc2cc(Cl)ccc2Cl)o1.
What is the InChIKey of [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine?
The InChIKey is VIGACGRDZRJINO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2NO2/c13-8-1-4-11(14)12(5-8)16-7-10-3-2-9(6-15)17-10/h1-5H,6-7,15H2.
What are the key properties of [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine?
[5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine has a molecular weight of 272.13 g/mol, XLogP of 3.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(2,5-dichlorophenoxy)methyl]furan-2-yl]methanamine is sourced from PubChem (CID 62452227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).