C14H17NO2 — CID 62452413
[5-[(2,4-dimethylphenoxy)methyl]furan-2-yl]methanamine (PubChem CID 62452413) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is [5-[(2,4-dimethylphenoxy)methyl]furan-2-yl]methanamine.
| Compound Name | [5-[(2,4-dimethylphenoxy)methyl]furan-2-yl]methanamine |
|---|---|
| PubChem CID | 62452413 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | [5-[(2,4-dimethylphenoxy)methyl]furan-2-yl]methanamine |
| SMILES | Cc1ccc(OCc2ccc(CN)o2)c(C)c1 |
| InChI | InChI=1S/C14H17NO2/c1-10-3-6-14(11(2)7-10)16-9-13-5-4-12(8-15)17-13/h3-7H,8-9,15H2,1-2H3 |
| InChIKey | QMVRABXBSSVMCZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |