C17H19N3O5 — CID 56798552
2-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]propanediamide (PubChem CID 56798552) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]propanediamide.
| Compound Name | 2-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]propanediamide |
|---|---|
| PubChem CID | 56798552 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[[5-[(2,4-dimethylphenoxy)methyl]furan-2-carbonyl]amino]propanediamide |
| SMILES | Cc1ccc(OCc2ccc(C(=O)NC(C(N)=O)C(N)=O)o2)c(C)c1 |
| InChI | InChI=1S/C17H19N3O5/c1-9-3-5-12(10(2)7-9)24-8-11-4-6-13(25-11)17(23)20-14(15(18)21)16(19)22/h3-7,14H,8H2,1-2H3,(H2,18,21)(H2,19,22)(H,20,23) |
| InChIKey | OBKGFCJBEGGADI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 137.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|