About [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine
[3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine (PubChem CID 62450219) has the molecular formula C16H13Cl2NO2
and a molecular weight of 322.19 g/mol. Its IUPAC name is [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine.
Molecular Properties
| Compound Name | [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine |
| PubChem CID | 62450219 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine |
| SMILES | NCc1oc2ccccc2c1COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2NO2/c17-10-5-6-13(18)15(7-10)20-9-12-11-3-1-2-4-14(11)21-16(12)8-19/h1-7H,8-9,19H2 |
| InChIKey | WHRSWTGQXMXGFZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine?
The IUPAC name of [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine (CID 62450219) is [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine.
What is the SMILES notation for [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine?
The canonical SMILES for [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine is NCc1oc2ccccc2c1COc1cc(Cl)ccc1Cl.
What is the InChIKey of [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine?
The InChIKey is WHRSWTGQXMXGFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13Cl2NO2/c17-10-5-6-13(18)15(7-10)20-9-12-11-3-1-2-4-14(11)21-16(12)8-19/h1-7H,8-9,19H2.
What are the key properties of [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine?
[3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine has a molecular weight of 322.19 g/mol, XLogP of 4.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2,5-dichlorophenoxy)methyl]-1-benzofuran-2-yl]methanamine is sourced from PubChem (CID 62450219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).