C14H11ClO6 — CID 2602831
methyl 5-[(5-chloro-2-hydroxybenzoyl)oxymethyl]furan-2-carboxylate (PubChem CID 2602831) has the molecular formula C14H11ClO6 and a molecular weight of 310.69 g/mol. Its IUPAC name is methyl 5-[(5-chloro-2-hydroxybenzoyl)oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(5-chloro-2-hydroxybenzoyl)oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 2602831 |
| Molecular Formula | C14H11ClO6 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | methyl 5-[(5-chloro-2-hydroxybenzoyl)oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2cc(Cl)ccc2O)o1 |
| InChI | InChI=1S/C14H11ClO6/c1-19-14(18)12-5-3-9(21-12)7-20-13(17)10-6-8(15)2-4-11(10)16/h2-6,16H,7H2,1H3 |
| InChIKey | YRQYQMFQYVWYHI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |