C21H20ClNO6 — CID 7175370
(5-methoxycarbonylfuran-2-yl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 7175370) has the molecular formula C21H20ClNO6 and a molecular weight of 417.85 g/mol. Its IUPAC name is (5-methoxycarbonylfuran-2-yl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | (5-methoxycarbonylfuran-2-yl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7175370 |
| Molecular Formula | C21H20ClNO6 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (5-methoxycarbonylfuran-2-yl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2cc(C)n(-c3cc(Cl)ccc3OC)c2C)o1 |
| InChI | InChI=1S/C21H20ClNO6/c1-12-9-16(13(2)23(12)17-10-14(22)5-7-18(17)26-3)20(24)28-11-15-6-8-19(29-15)21(25)27-4/h5-10H,11H2,1-4H3 |
| InChIKey | FXRRNBUXEIGLKJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 79.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|