C21H19ClFNO3 — CID 7175379
(4-fluorophenyl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 7175379) has the molecular formula C21H19ClFNO3 and a molecular weight of 387.84 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | (4-fluorophenyl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 7175379 |
| Molecular Formula | C21H19ClFNO3 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (4-fluorophenyl)methyl 1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(C(=O)OCc2ccc(F)cc2)c1C |
| InChI | InChI=1S/C21H19ClFNO3/c1-13-10-18(21(25)27-12-15-4-7-17(23)8-5-15)14(2)24(13)19-11-16(22)6-9-20(19)26-3/h4-11H,12H2,1-3H3 |
| InChIKey | MCNYLYTWPXEJCK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|