About (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate
(3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate (PubChem CID 60643048) has the molecular formula C15H13ClFNO3
and a molecular weight of 309.72 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate.
Molecular Properties
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate |
| PubChem CID | 60643048 |
| Molecular Formula | C15H13ClFNO3 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate |
| SMILES | COc1ccc(COC(=O)c2ccc(Cl)cc2N)cc1F |
| InChI | InChI=1S/C15H13ClFNO3/c1-20-14-5-2-9(6-12(14)17)8-21-15(19)11-4-3-10(16)7-13(11)18/h2-7H,8,18H2,1H3 |
| InChIKey | CTEAUNLVQVTPIU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate?
The IUPAC name of (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate (CID 60643048) is (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate.
What is the SMILES notation for (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate?
The canonical SMILES for (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate is COc1ccc(COC(=O)c2ccc(Cl)cc2N)cc1F.
What is the InChIKey of (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate?
The InChIKey is CTEAUNLVQVTPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClFNO3/c1-20-14-5-2-9(6-12(14)17)8-21-15(19)11-4-3-10(16)7-13(11)18/h2-7H,8,18H2,1H3.
What are the key properties of (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate?
(3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate has a molecular weight of 309.72 g/mol, XLogP of 3.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4-methoxyphenyl)methyl 2-amino-4-chlorobenzoate is sourced from PubChem (CID 60643048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).