C17H17FO5 — CID 2629800
(3-fluoro-4-methoxyphenyl)methyl 3,5-dimethoxybenzoate (PubChem CID 2629800) has the molecular formula C17H17FO5 and a molecular weight of 320.32 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 3,5-dimethoxybenzoate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 2629800 |
| Molecular Formula | C17H17FO5 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCc2ccc(OC)c(F)c2)c1 |
| InChI | InChI=1S/C17H17FO5/c1-20-13-7-12(8-14(9-13)21-2)17(19)23-10-11-4-5-16(22-3)15(18)6-11/h4-9H,10H2,1-3H3 |
| InChIKey | KVTPBUNXBNAYCC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |