About (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate
(3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate (PubChem CID 2627760) has the molecular formula C15H13FO4
and a molecular weight of 276.26 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate.
Molecular Properties
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate |
| PubChem CID | 2627760 |
| Molecular Formula | C15H13FO4 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate |
| SMILES | COc1ccc(COC(=O)c2cccc(O)c2)cc1F |
| InChI | InChI=1S/C15H13FO4/c1-19-14-6-5-10(7-13(14)16)9-20-15(18)11-3-2-4-12(17)8-11/h2-8,17H,9H2,1H3 |
| InChIKey | ZMTWSYVCGFUUQE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate?
The IUPAC name of (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate (CID 2627760) is (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate.
What is the SMILES notation for (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate?
The canonical SMILES for (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate is COc1ccc(COC(=O)c2cccc(O)c2)cc1F.
What is the InChIKey of (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate?
The InChIKey is ZMTWSYVCGFUUQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13FO4/c1-19-14-6-5-10(7-13(14)16)9-20-15(18)11-3-2-4-12(17)8-11/h2-8,17H,9H2,1H3.
What are the key properties of (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate?
(3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate has a molecular weight of 276.26 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluoro-4-methoxyphenyl)methyl 3-hydroxybenzoate is sourced from PubChem (CID 2627760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).