C21H17NO10 — CID 2627632
bis[(5-methoxycarbonylfuran-2-yl)methyl] pyridine-2,6-dicarboxylate (PubChem CID 2627632) has the molecular formula C21H17NO10 and a molecular weight of 443.36 g/mol. Its IUPAC name is bis[(5-methoxycarbonylfuran-2-yl)methyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[(5-methoxycarbonylfuran-2-yl)methyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 2627632 |
| Molecular Formula | C21H17NO10 |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | bis[(5-methoxycarbonylfuran-2-yl)methyl] pyridine-2,6-dicarboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)c2cccc(C(=O)OCc3ccc(C(=O)OC)o3)n2)o1 |
| InChI | InChI=1S/C21H17NO10/c1-27-20(25)16-8-6-12(31-16)10-29-18(23)14-4-3-5-15(22-14)19(24)30-11-13-7-9-17(32-13)21(26)28-2/h3-9H,10-11H2,1-2H3 |
| InChIKey | JGKAJFUTWODCPU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 144.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|