methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate

C16H16O7 — CID 2516450

IUPACmethyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate
SMILESCOC(=O)c1ccc(COC(=O)c2cc(OC)cc(OC)c2)o1
InChIInChI=1S/C16H16O7/c1-19-12-6-10(7-13(8-12)20-2)15(17)22-9-11-4-5-14(23-11)16(18)21-3/h4-8H,9H2,1-3H3
InChIKeyDRQFYXCQUQPEIH-UHFFFAOYSA-N
MW320.30 g/mol
LogP2.44
Rot. Bonds6

About methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate

methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate (PubChem CID 2516450) has the molecular formula C16H16O7 and a molecular weight of 320.30 g/mol. Its IUPAC name is methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate
PubChem CID2516450
Molecular FormulaC16H16O7
Molecular Weight320.30 g/mol
Exact Mass320.09
IUPAC Namemethyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate
SMILESCOC(=O)c1ccc(COC(=O)c2cc(OC)cc(OC)c2)o1
InChIInChI=1S/C16H16O7/c1-19-12-6-10(7-13(8-12)20-2)15(17)22-9-11-4-5-14(23-11)16(18)21-3/h4-8H,9H2,1-3H3
InChIKeyDRQFYXCQUQPEIH-UHFFFAOYSA-N
XLogP2.44
TPSA84.20 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.30
LogP ≤ 52.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate (CID 2516450) is methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate is COC(=O)c1ccc(COC(=O)c2cc(OC)cc(OC)c2)o1.
What is the InChIKey of methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate?
The InChIKey is DRQFYXCQUQPEIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O7/c1-19-12-6-10(7-13(8-12)20-2)15(17)22-9-11-4-5-14(23-11)16(18)21-3/h4-8H,9H2,1-3H3.
What are the key properties of methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate?
methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate has a molecular weight of 320.30 g/mol, XLogP of 2.44, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(3,5-dimethoxybenzoyl)oxymethyl]furan-2-carboxylate is sourced from PubChem (CID 2516450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).