C20H16Cl2O5 — CID 19631643
[5-(2,3-dichlorophenyl)furan-2-yl]methyl 3,5-dimethoxybenzoate (PubChem CID 19631643) has the molecular formula C20H16Cl2O5 and a molecular weight of 407.25 g/mol. Its IUPAC name is [5-(2,3-dichlorophenyl)furan-2-yl]methyl 3,5-dimethoxybenzoate.
| Compound Name | [5-(2,3-dichlorophenyl)furan-2-yl]methyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 19631643 |
| Molecular Formula | C20H16Cl2O5 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | [5-(2,3-dichlorophenyl)furan-2-yl]methyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCc2ccc(-c3cccc(Cl)c3Cl)o2)c1 |
| InChI | InChI=1S/C20H16Cl2O5/c1-24-14-8-12(9-15(10-14)25-2)20(23)26-11-13-6-7-18(27-13)16-4-3-5-17(21)19(16)22/h3-10H,11H2,1-2H3 |
| InChIKey | PFUHVBQDCYCRAL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |