C21H18Cl2O4 — CID 19631409
[5-(2,3-dichlorophenyl)furan-2-yl]methyl 4-propan-2-yloxybenzoate (PubChem CID 19631409) has the molecular formula C21H18Cl2O4 and a molecular weight of 405.28 g/mol. Its IUPAC name is [5-(2,3-dichlorophenyl)furan-2-yl]methyl 4-propan-2-yloxybenzoate.
| Compound Name | [5-(2,3-dichlorophenyl)furan-2-yl]methyl 4-propan-2-yloxybenzoate |
|---|---|
| PubChem CID | 19631409 |
| Molecular Formula | C21H18Cl2O4 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | [5-(2,3-dichlorophenyl)furan-2-yl]methyl 4-propan-2-yloxybenzoate |
| SMILES | CC(C)Oc1ccc(C(=O)OCc2ccc(-c3cccc(Cl)c3Cl)o2)cc1 |
| InChI | InChI=1S/C21H18Cl2O4/c1-13(2)26-15-8-6-14(7-9-15)21(24)25-12-16-10-11-19(27-16)17-4-3-5-18(22)20(17)23/h3-11,13H,12H2,1-2H3 |
| InChIKey | XOWPSQWWHDXUNZ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |