C18H15Cl2NO3 — CID 3730730
2-methylpropyl 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoate (PubChem CID 3730730) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is 2-methylpropyl 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoate.
| Compound Name | 2-methylpropyl 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3730730 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-methylpropyl 2-cyano-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoate |
| SMILES | CC(C)COC(=O)C(C#N)=Cc1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C18H15Cl2NO3/c1-11(2)10-23-18(22)12(9-21)8-13-6-7-16(24-13)14-4-3-5-15(19)17(14)20/h3-8,11H,10H2,1-2H3 |
| InChIKey | MYDYFAXWJCIQSK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|