About methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate
methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate (PubChem CID 29390529) has the molecular formula C18H16Cl2N2O7
and a molecular weight of 443.24 g/mol. Its IUPAC name is methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate |
| PubChem CID | 29390529 |
| Molecular Formula | C18H16Cl2N2O7 |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COC(=O)CNC(=O)CNC(=O)c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C18H16Cl2N2O7/c1-27-18(26)14-5-3-11(29-14)9-28-16(24)8-21-15(23)7-22-17(25)12-4-2-10(19)6-13(12)20/h2-6H,7-9H2,1H3,(H,21,23)(H,22,25) |
| InChIKey | LMAZWBOAPDYSGS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate?
The IUPAC name of methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate (CID 29390529) is methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate.
What is the SMILES notation for methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate?
The canonical SMILES for methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate is COC(=O)c1ccc(COC(=O)CNC(=O)CNC(=O)c2ccc(Cl)cc2Cl)o1.
What is the InChIKey of methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate?
The InChIKey is LMAZWBOAPDYSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16Cl2N2O7/c1-27-18(26)14-5-3-11(29-14)9-28-16(24)8-21-15(23)7-22-17(25)12-4-2-10(19)6-13(12)20/h2-6H,7-9H2,1H3,(H,21,23)(H,22,25).
What are the key properties of methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate?
methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate has a molecular weight of 443.24 g/mol, XLogP of 1.96, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[2-[[2-[(2,4-dichlorobenzoyl)amino]acetyl]amino]acetyl]oxymethyl]furan-2-carboxylate is sourced from PubChem (CID 29390529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).