C15H19Cl2N3O3 — CID 36930188
N-[2-[[2-(butylamino)-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide (PubChem CID 36930188) has the molecular formula C15H19Cl2N3O3 and a molecular weight of 360.24 g/mol. Its IUPAC name is N-[2-[[2-(butylamino)-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide.
| Compound Name | N-[2-[[2-(butylamino)-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 36930188 |
| Molecular Formula | C15H19Cl2N3O3 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[2-[[2-(butylamino)-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide |
| SMILES | CCCCNC(=O)CNC(=O)CNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N3O3/c1-2-3-6-18-13(21)8-19-14(22)9-20-15(23)11-5-4-10(16)7-12(11)17/h4-5,7H,2-3,6,8-9H2,1H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | NDZCOYIMJLJTJJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|