C21H21Cl2N5O3 — CID 22108871
N-[2-[[2-[3-(benzimidazol-1-yl)propylamino]-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide (PubChem CID 22108871) has the molecular formula C21H21Cl2N5O3 and a molecular weight of 462.34 g/mol. Its IUPAC name is N-[2-[[2-[3-(benzimidazol-1-yl)propylamino]-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide.
| Compound Name | N-[2-[[2-[3-(benzimidazol-1-yl)propylamino]-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 22108871 |
| Molecular Formula | C21H21Cl2N5O3 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[2-[[2-[3-(benzimidazol-1-yl)propylamino]-2-oxoethyl]amino]-2-oxoethyl]-2,4-dichlorobenzamide |
| SMILES | O=C(CNC(=O)CNC(=O)c1ccc(Cl)cc1Cl)NCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C21H21Cl2N5O3/c22-14-6-7-15(16(23)10-14)21(31)26-12-20(30)25-11-19(29)24-8-3-9-28-13-27-17-4-1-2-5-18(17)28/h1-2,4-7,10,13H,3,8-9,11-12H2,(H,24,29)(H,25,30)(H,26,31) |
| InChIKey | PUUXAYCVHRJCME-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|