C23H21Cl2N3O4 — CID 26976720
2,4-dichloro-N-[2-[[2-(2-naphthalen-2-yloxyethylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide (PubChem CID 26976720) has the molecular formula C23H21Cl2N3O4 and a molecular weight of 474.34 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[[2-(2-naphthalen-2-yloxyethylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[[2-(2-naphthalen-2-yloxyethylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 26976720 |
| Molecular Formula | C23H21Cl2N3O4 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.09 |
| IUPAC Name | 2,4-dichloro-N-[2-[[2-(2-naphthalen-2-yloxyethylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)CNC(=O)c1ccc(Cl)cc1Cl)NCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H21Cl2N3O4/c24-17-6-8-19(20(25)12-17)23(31)28-14-22(30)27-13-21(29)26-9-10-32-18-7-5-15-3-1-2-4-16(15)11-18/h1-8,11-12H,9-10,13-14H2,(H,26,29)(H,27,30)(H,28,31) |
| InChIKey | IVYAHTWLRFAUEY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|