C19H15Cl2NO2 — CID 19174593
2,4-dichloro-N-(2-naphthalen-1-yloxyethyl)benzamide (PubChem CID 19174593) has the molecular formula C19H15Cl2NO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is 2,4-dichloro-N-(2-naphthalen-1-yloxyethyl)benzamide.
| Compound Name | 2,4-dichloro-N-(2-naphthalen-1-yloxyethyl)benzamide |
|---|---|
| PubChem CID | 19174593 |
| Molecular Formula | C19H15Cl2NO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 2,4-dichloro-N-(2-naphthalen-1-yloxyethyl)benzamide |
| SMILES | O=C(NCCOc1cccc2ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H15Cl2NO2/c20-14-8-9-16(17(21)12-14)19(23)22-10-11-24-18-7-3-5-13-4-1-2-6-15(13)18/h1-9,12H,10-11H2,(H,22,23) |
| InChIKey | OKTFJZHVLKIRRI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|