C22H20ClNO5 — CID 9491672
[2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate (PubChem CID 9491672) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate.
| Compound Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 9491672 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [2-[2-(4-chlorophenoxy)ethylamino]-2-oxoethyl] 2-naphthalen-2-yloxyacetate |
| SMILES | O=C(COC(=O)COc1ccc2ccccc2c1)NCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClNO5/c23-18-6-9-19(10-7-18)27-12-11-24-21(25)14-29-22(26)15-28-20-8-5-16-3-1-2-4-17(16)13-20/h1-10,13H,11-12,14-15H2,(H,24,25) |
| InChIKey | KKPPHBLHMWDZEQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|