About 2-bromoethyl 2-naphthalen-2-yloxyacetate
2-bromoethyl 2-naphthalen-2-yloxyacetate (PubChem CID 22163309) has the molecular formula C14H13BrO3
and a molecular weight of 309.16 g/mol. Its IUPAC name is 2-bromoethyl 2-naphthalen-2-yloxyacetate.
Molecular Properties
| Compound Name | 2-bromoethyl 2-naphthalen-2-yloxyacetate |
| PubChem CID | 22163309 |
| Molecular Formula | C14H13BrO3 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-bromoethyl 2-naphthalen-2-yloxyacetate |
| SMILES | O=C(COc1ccc2ccccc2c1)OCCBr |
| InChI | InChI=1S/C14H13BrO3/c15-7-8-17-14(16)10-18-13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9H,7-8,10H2 |
| InChIKey | CMVXSMNZSBGISY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl 2-naphthalen-2-yloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl 2-naphthalen-2-yloxyacetate?
The IUPAC name of 2-bromoethyl 2-naphthalen-2-yloxyacetate (CID 22163309) is 2-bromoethyl 2-naphthalen-2-yloxyacetate.
What is the SMILES notation for 2-bromoethyl 2-naphthalen-2-yloxyacetate?
The canonical SMILES for 2-bromoethyl 2-naphthalen-2-yloxyacetate is O=C(COc1ccc2ccccc2c1)OCCBr.
What is the InChIKey of 2-bromoethyl 2-naphthalen-2-yloxyacetate?
The InChIKey is CMVXSMNZSBGISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrO3/c15-7-8-17-14(16)10-18-13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9H,7-8,10H2.
What are the key properties of 2-bromoethyl 2-naphthalen-2-yloxyacetate?
2-bromoethyl 2-naphthalen-2-yloxyacetate has a molecular weight of 309.16 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl 2-naphthalen-2-yloxyacetate is sourced from PubChem (CID 22163309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).