C14H14O4 — CID 21297754
2-hydroxyethyl 2-naphthalen-2-yloxyacetate (PubChem CID 21297754) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-hydroxyethyl 2-naphthalen-2-yloxyacetate.
| Compound Name | 2-hydroxyethyl 2-naphthalen-2-yloxyacetate |
|---|---|
| PubChem CID | 21297754 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 2-hydroxyethyl 2-naphthalen-2-yloxyacetate |
| SMILES | O=C(COc1ccc2ccccc2c1)OCCO |
| InChI | InChI=1S/C14H14O4/c15-7-8-17-14(16)10-18-13-6-5-11-3-1-2-4-12(11)9-13/h1-6,9,15H,7-8,10H2 |
| InChIKey | XHKSDUJZFQZOFT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |